Tradlon Chemical Co., Ltd.
Mobile: +86-13367102998
E-mail: xf_sdj001@sina.com
tradlonchem@163.com
Add: 83 Panggong Road, Xiangcheng District, Xiangyang City, Hubei, China
Product
4'-Chloro-3,4-dihydroxybenzophenone
Name: 4'-Chloro-3,4-dihydroxybenzophenone
| English name: | 4'-Chloro-3,4-dihydroxybenzophenone | |
| CAS NO: | 134612-84-3 | |
| Molecular weight: | 248.6618 | |
| EC NO: | No data | |
| Molecular formula: | C13H9ClO3 | |
| InChI: | InChI=1/C13H9ClO3/c14-10-4-1-8(2-5-10)13(17)9-3-6-11(15)12(16)7-9/h1-7,15-16H | |
| Structural formula: | ||

